m Formula fontification
|
Importing Wikidata short description: "Chemical compound"
|
||
(8 intermediate revisions by 6 users not shown) | |||
Line 1:
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 401940746
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate
| image = calcium glucoheptonate.png
<!--Clinical data-->
| tradename =
Line 17 ⟶ 18:
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
Line 24:
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 29039-00-7
Line 32 ⟶ 30:
| ATC_suffix = AA10
| PubChem = 28327
| DrugBank_Ref = {{drugbankcite|
| DrugBank = DB00326
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16741933
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = L11651398J
<!--Chemical data-->
| C=14 | H=26 | Ca=1 | O=16
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1
Line 51 ⟶ 45:
}}
'''Calcium glucoheptonate''' is a highly water soluble [[Dietary mineral|mineral supplement]].<ref name="Wiria_2020">{{cite journal | vauthors = Wiria M, Tran HM, Nguyen PH, Valencia O, Dutta S, Pouteau E | title = Relative bioavailability and pharmacokinetic comparison of calcium glucoheptonate with calcium carbonate | journal = Pharmacology Research & Perspectives | volume = 8 | issue = 2 | pages = e00589 | date = April 2020 | pmid = 32302064 | pmc = 7164401 | doi = 10.1002/prp2.589 }}</ref>
== References ==
{{Reflist}}
{{Mineral supplements}}
{{Calcium compounds}}
[[Category:Calcium compounds]]
|