|
m Formula fontification
|
Importing Wikidata short description: "Chemical compound"
|
||
| (8 intermediate revisions by 6 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
| Verifiedfields = changed |
||
| Watchedfields = changed |
|||
| verifiedrevid = 401940746 |
| verifiedrevid = 401940746 |
||
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
||
| image = calcium glucoheptonate.png |
| image = calcium glucoheptonate.png |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Line 17: | Line 18: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| Line 24: | Line 24: | ||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 29039-00-7 |
| CAS_number = 29039-00-7 |
||
| Line 32: | Line 30: | ||
| ATC_suffix = AA10 |
| ATC_suffix = AA10 |
||
| PubChem = 28327 |
| PubChem = 28327 |
||
| DrugBank_Ref = {{drugbankcite| |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
||
| DrugBank = |
| DrugBank = DB00326 |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 16741933 |
| ChemSpiderID = 16741933 |
||
| UNII_Ref = {{fdacite|changed|FDA}} |
| UNII_Ref = {{fdacite|changed|FDA}} |
||
| UNII = L11651398J |
| UNII = L11651398J |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=14 | H=26 | Ca=1 | O=16 |
| C=14 | H=26 | Ca=1 | O=16 |
||
| molecular_weight = 490.425 g/mol |
|||
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
| smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO |
||
| InChI = 1/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 |
|||
| InChIKey = FATUQANACHZLRT-DKUZMZKCBH |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 |
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 |
||
| Line 51: | Line 45: | ||
}} |
}} |
||
'''Calcium glucoheptonate''' is a highly water soluble [[Dietary mineral|mineral supplement]].<ref name="Wiria_2020">{{cite journal | vauthors = Wiria M, Tran HM, Nguyen PH, Valencia O, Dutta S, Pouteau E | title = Relative bioavailability and pharmacokinetic comparison of calcium glucoheptonate with calcium carbonate | journal = Pharmacology Research & Perspectives | volume = 8 | issue = 2 | pages = e00589 | date = April 2020 | pmid = 32302064 | pmc = 7164401 | doi = 10.1002/prp2.589 }}</ref> |
|||
'''Calcium glucoheptonate''' is a [[Dietary mineral|mineral supplement]]. |
|||
== References == |
|||
{{Reflist}} |
|||
{{Mineral supplements}} |
{{Mineral supplements}} |
||
{{Calcium compounds}} |
|||
[[Category:Calcium compounds]] |
[[Category:Calcium compounds]] |
||
 | |
| Clinical data | |
|---|---|
| AHFS/Drugs.com | International Drug Names |
| ATC code | |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| DrugBank |
|
| ChemSpider |
|
| UNII | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.044.880  |
| Chemical and physical data | |
| Formula | C14H26CaO16 |
| Molar mass | 490.424 g·mol−1 |
| 3D model (JSmol) | |
| |
| |
 N Y (what is this?) (verify) | |
Calcium glucoheptonate is a highly water soluble mineral supplement.[1]
|
| |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Major |
| ||||||||||||
| Trace |
| ||||||||||||
| Ultratrace |
| ||||||||||||
| |||||||||||||
 | This drug article relating to the gastrointestinal system is a stub. You can help Wikipedia by expanding it. |
